CAS 2445-81-0: 2H-1-Benzopyran-2-one,8-methoxy-

Description:2H-1-Benzopyran-2-one, 8-methoxy- is a chemical compound belonging to the class of flavonoids, which are known for their diverse biological activities. This compound features a benzopyran structure, characterized by a fused benzene and pyran ring, with a methoxy group (-OCH3) attached at the 8-position. It is typically a yellow to orange crystalline solid, exhibiting solubility in organic solvents such as ethanol and methanol, while being less soluble in water. The presence of the methoxy group can influence its chemical reactivity and biological properties, potentially enhancing its antioxidant and anti-inflammatory activities. This compound may also exhibit fluorescence, making it useful in various analytical applications. Additionally, flavonoids like this one are often studied for their potential health benefits, including their role in plant pigmentation and their effects on human health, such as anti-cancer and cardioprotective properties. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula:C₁₀H₈O₃

InChI:InChI=1S/C10H8O3/c1-12-8-4-2-3-7-5-6-9(11)13-10(7)8/h2-6H,1H3

InChI key:InChIKey=ODRDTKMYQDXVGG-UHFFFAOYSA-N

SMILES:O=C1OC=2C(OC)=CC=CC2C=C1

Synonyms:
8-Methoxy-2H-1-benzopyran-2-one
8-Methoxycoumarin
Coumarin, 8-methoxy-
Coumarin,8-methoxy- (6CI,7CI,8CI)

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2H-1-Benzopyran-2-one,8-methoxy- REF: IN-DA007N3PCAS: 2445-81-0	98%	To inquire	Thu 27 Mar 25
8-Methoxy-2H-chromen-2-one REF: 54-OR81233CAS: 2445-81-0	98%	77.00 €~819.00 €	Fri 28 Mar 25
8-Methoxy-2H-chromen-2-one REF: 10-F602149CAS: 2445-81-0	97%	21.00 €~179.00 €	Tue 01 Apr 25
8-Methoxycoumarin REF: TR-M299275CAS: 2445-81-0	- - -	230.00 €	Tue 08 Apr 25
8-Methoxycoumarin REF: 3D-CAA44581CAS: 2445-81-0	Min. 95%	- - -	Discontinued product