CAS 24460-11-5: 2-{[4-(dimethylamino)-2-hydroxyphenyl]carbonyl}benzoate

Description:2-{[4-(Dimethylamino)-2-hydroxyphenyl]carbonyl}benzoate, identified by its CAS number 24460-11-5, is an organic compound characterized by its complex structure that includes a benzoate moiety and a dimethylamino group. This compound typically exhibits properties associated with both aromatic and polar functionalities, which can influence its solubility and reactivity. The presence of the dimethylamino group suggests potential basicity, while the hydroxy group can participate in hydrogen bonding, enhancing its solubility in polar solvents. The carbonyl group contributes to the compound's reactivity, making it a potential candidate for various chemical reactions, including acylation and esterification. Additionally, the compound may exhibit biological activity, which is common among derivatives of aromatic amines and phenolic compounds. Its structural features may also allow for interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique combination of functional groups positions it as a versatile substance in both synthetic and applied chemistry contexts.

Formula:C₁₆H₁₄NO₄

InChI:InChI=1/C16H15NO4/c1-17(2)10-7-8-13(14(18)9-10)15(19)11-5-3-4-6-12(11)16(20)21/h3-9,18H,1-2H3,(H,20,21)/p-1

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-(4-DIMETHYLAMINO-2-HYDROXY-BENZOYL)-BENZOIC ACID REF: IN-DA00BDK5CAS: 24460-11-5	- - -	To inquire	Thu 27 Mar 25
2-(4-Dimethylamino-2-hydroxy-benzoyl)-benzoic acid REF: 10-F028464CAS: 24460-11-5	- - -	- - -	Discontinued product
2-(4-Dimethylamino-2-hydroxy-benzoyl)-benzoic acid REF: 3D-ZAA46011CAS: 24460-11-5	Min. 95%	- - -	Discontinued product