CAS 246160-12-3: 1-pyridin-2-ylhexane-1,5-dione

Description: 1-Pyridin-2-ylhexane-1,5-dione, with the CAS number 246160-12-3, is an organic compound characterized by its unique structure that includes a pyridine ring and a hexane backbone featuring two carbonyl groups at the 1 and 5 positions. This compound typically exhibits properties associated with diketones, such as the ability to participate in various chemical reactions, including condensation and oxidation. The presence of the pyridine moiety contributes to its potential as a ligand in coordination chemistry and may influence its solubility and reactivity. Additionally, the compound may display biological activity, making it of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 1-pyridin-2-ylhexane-1,5-dione is a versatile compound with applications in research and industry, particularly in the synthesis of more complex organic molecules.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1/C11H13NO2/c1-9(13)5-4-7-11(14)10-6-2-3-8-12-10/h2-3,6,8H,4-5,7H2,1H3

1,5-Hexanedione, 1-(2-pyridinyl)-

CAS: 246160-12-3

• Formula: C₁₁H₁₃NO₂
• Molecular weight: 191.2264

1-(2-pyridyl)hexan-1,5-dione

CAS: 246160-12-3

• Purity: 97.0%
• Molecular weight: 191.22999572753906

1-(2-Pyridyl)hexan-1,5-dione

CAS: 246160-12-3

Versatile small molecule scaffold

• Formula: C₁₁H₁₃NO₂
• Purity: Min. 95%
• Molecular weight: 191.23 g/mol