CAS 2466-09-3: Pyrophosphoric acid
Description:Pyrophosphoric acid, with the CAS number 2466-09-3, is a chemical compound characterized by its formula H4P2O7. It is a colorless, viscous liquid that is highly soluble in water, forming a strong acidic solution. Pyrophosphoric acid is a diprotic acid, meaning it can donate two protons (H⁺ ions) in aqueous solution, which contributes to its strong acidity. It is often used in various applications, including as a reagent in biochemical research and as a component in fertilizers. The compound is known for its ability to form phosphates, which are essential in biological systems. Additionally, pyrophosphoric acid can act as a dehydrating agent and is involved in the synthesis of other phosphorus-containing compounds. Due to its corrosive nature, it requires careful handling and storage to prevent chemical burns and reactions with incompatible materials. Overall, pyrophosphoric acid plays a significant role in both industrial and laboratory settings due to its unique chemical properties.
Formula:H4O7P2
InChI:InChI=1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)
InChI key:InChIKey=XPPKVPWEQAFLFU-UHFFFAOYSA-N
SMILES:O=P(O)(O)OP(=O)(O)O
- Synonyms:
- Acide Pyrophosphorique
- Acido Pirofosforico
- Diphosphoric acid (H4P2O7)
- Diphosphoric acid (H<sub>4</sub>P<sub>2</sub>O<sub>7</sub>)
- Diphosphorsaeure
- Pyrophosphoric Acid
- Pyrophosphorsaure
- Diphosphoric acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Diphosphoric acid REF: IN-DA002OZICAS: 2466-09-3 | 90% | 33.00 €~63.00 € | Thu 27 Mar 25 |
![]() | Pyrophosphoric acid REF: 3D-CAA46609CAS: 2466-09-3 | - - - | - - - | Discontinued product |

Diphosphoric acid
Ref: IN-DA002OZI
100g | 33.00 € | ||
500g | 63.00 € |

Pyrophosphoric acid
Ref: 3D-CAA46609
1kg | Discontinued | Request information | |
2kg | Discontinued | Request information | |
500g | Discontinued | Request information |