CAS 247170-17-8: 2,4,5-Trifluorocinnamic acid

Description:2,4,5-Trifluorocinnamic acid is an organic compound characterized by its unique structure, which features a cinnamic acid backbone with three fluorine atoms substituted at the 2, 4, and 5 positions of the aromatic ring. This substitution significantly influences its chemical properties, including increased lipophilicity and altered reactivity compared to non-fluorinated analogs. The presence of the carboxylic acid functional group imparts acidity, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the trifluoromethyl groups enhance the compound's stability and can affect its biological activity, making it of interest in pharmaceutical research. The compound is typically a solid at room temperature and may exhibit specific melting and boiling points, solubility characteristics, and spectral properties that are useful for identification and analysis. Its unique fluorinated structure may also confer distinctive electronic and steric properties, making it a valuable compound in materials science and organic synthesis.

Formula:C₉H₅F₃O₂

InChI:InChI=1/C9H5F3O2/c10-6-4-8(12)7(11)3-5(6)1-2-9(13)14/h1-4H,(H,13,14)/b2-1+

Synonyms:
(2E)-3-(2,4,5-Trifluorophenyl)acrylic acid
247170-17-8
QV1U1R BF DF EF & & trans or E Form
(2E)-3-(2,4,5-trifluorophenyl)prop-2-enoic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Propenoic acid, 3-(2,4,5-trifluorophenyl)- REF: IN-DA002P6WCAS: 247170-17-8	- - -	To inquire	Thu 27 Mar 25
2,4,5-Trifluorocinnamic acid REF: 54-PC9367CAS: 247170-17-8	98%	32.00 €~134.00 €	Fri 28 Mar 25
2,4,5-Trifluorocinnamic acid REF: 10-F007973CAS: 247170-17-8	95.0%	To inquire	Tue 08 Apr 25
(2E)-3-(2,4,5-Trifluorophenyl)Acrylic Acid REF: 3D-FT87187CAS: 247170-17-8	Min. 95%	- - -	Discontinued product