CAS 247254-47-3: 1-(3-Bromo-4-methoxyphenyl)methanamine

Description:1-(3-Bromo-4-methoxyphenyl)methanamine, with the CAS number 247254-47-3, is an organic compound characterized by its amine functional group attached to a phenyl ring that is further substituted with a bromine atom and a methoxy group. The presence of the bromine atom introduces notable electrophilic properties, while the methoxy group enhances the compound's electron-donating characteristics, influencing its reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups present. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the modifications on the phenyl ring can significantly affect biological activity. Additionally, the compound's synthesis and reactivity can be influenced by the presence of the bromine and methoxy substituents, making it a subject of interest in organic synthesis and material science. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula:C₈H₁₀BrNO

InChI:InChI=1/C8H10BrNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,5,10H2,1H3

Synonyms:
Benzenemethanamine, 3-Bromo-4-Methoxy-
3-Bromo-4-methoxy-benzenemethanamine

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Benzenemethanamine, 3-bromo-4-methoxy- REF: IN-DA002P8LCAS: 247254-47-3	- - -	To inquire	Thu 27 Mar 25
3-Bromo-4-methoxybenzylamine REF: 54-OR470896CAS: 247254-47-3	- - -	To inquire	Thu 03 Apr 25
3-Bromo-4-methoxybenzylamine REF: 3D-FB157621CAS: 247254-47-3	Min. 95%	- - -	Discontinued product