CAS 24730-31-2: surfactin from bacillus subtilis
Description:Surfactin is a lipopeptide biosurfactant produced by the bacterium Bacillus subtilis, known for its unique amphiphilic structure, which consists of a cyclic peptide linked to a long fatty acid chain. This structure allows surfactin to significantly reduce surface tension and interfacial tension, making it an effective emulsifying agent. Surfactin exhibits a range of biological activities, including antimicrobial, antiviral, and antifungal properties, which contribute to its potential applications in pharmaceuticals, agriculture, and environmental remediation. The compound is characterized by its ability to form micelles and stabilize emulsions, enhancing the solubility of hydrophobic compounds. Additionally, surfactin is biodegradable and environmentally friendly, making it a sustainable alternative to synthetic surfactants. Its production can be influenced by various factors, including nutrient availability and fermentation conditions, which can affect yield and activity. Overall, surfactin's multifunctional properties and eco-friendly nature position it as a valuable compound in various industrial and biotechnological applications.
Formula:C53H93N7O13
InChI:InChI=1/C53H93N7O13/c1-30(2)20-18-16-14-13-15-17-19-21-36-28-43(61)54-37(22-23-44(62)63)47(66)55-38(24-31(3)4)48(67)57-40(26-33(7)8)51(70)60-46(35(11)12)52(71)58-41(29-45(64)65)50(69)56-39(25-32(5)6)49(68)59-42(27-34(9)10)53(72)73-36/h30-42,46H,13-29H2,1-12H3,(H,54,61)(H,55,66)(H,56,69)(H,57,67)(H,58,71)(H,59,68)(H,60,70)(H,62,63)(H,64,65)/t36-,37+,38+,39-,40-,41+,42+,46+/m1/s1
- Synonyms:
- Surfactin
- 3-[(9S,12S,15R,18S,21R)-9-(carboxymethyl)-3,6,15,18-tetrakis(2-methylpropyl)-25-(10-methylundecyl)-2,5,8,11,14,17,20,23-octaoxo-12-(propan-2-yl)-1-oxa-4,7,10,13,16,19,22-heptaazacyclopentacosan-21-yl]propanoic acid
- 3-[(3S,6R,9S,12S,15R,18S,21S,25R)-9-(carboxymethyl)-3,6,15,18-tetrakis(2-methylpropyl)-25-(10-methylundecyl)-2,5,8,11,14,17,20,23-octaoxo-12-(propan-2-yl)-1-oxa-4,7,10,13,16,19,22-heptaazacyclopentacosan-21-yl]propanoic acid