CAS 247564-66-5: 4,6-Difluoroindole-2-carboxylic acid

Description:4,6-Difluoroindole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of two fluorine atoms at the 4 and 6 positions of the indole ring significantly influences its chemical properties, including its reactivity and polarity. The carboxylic acid functional group at the 2 position contributes to its acidity and solubility in polar solvents. This compound is of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing various derivatives. Its fluorinated nature may enhance lipophilicity and metabolic stability, making it a candidate for drug development. Additionally, the compound's unique structure allows for various synthetic modifications, which can lead to the exploration of new pharmacological applications. Overall, 4,6-Difluoroindole-2-carboxylic acid is a versatile compound with significant implications in research and development within the chemical and pharmaceutical industries.

Formula:C₉H₅F₂NO₂

InChI:InChI=1S/C9H5F2NO2/c10-4-1-6(11)5-3-8(9(13)14)12-7(5)2-4/h1-3,12H,(H,13,14)

InChI key:InChIKey=OCHGGXDZJGAUEU-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC=2C(F)=CC(F)=CC2N1

Synonyms:
1H-indole-2-carboxylic acid, 4,6-difluoro-
T56 Bmj Cvq Ff Hf
4,6-difluoro-1H-indole-2-carboxylic acid

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1H-Indole-2-carboxylic acid, 4,6-difluoro- REF: IN-DA002PC8CAS: 247564-66-5	97%	To inquire	Thu 27 Mar 25
4,6-Difluoroindole-2-carboxylic acid REF: 54-PC3022CAS: 247564-66-5	98+%	118.00 €	Fri 28 Mar 25
4,6-Difluoroindole-2-carboxylic acid REF: 7W-GK3220CAS: 247564-66-5	- - -	To inquire	Fri 28 Mar 25
4,6-Difluoroindole-2-carboxylic acid REF: 10-F050360CAS: 247564-66-5	98.0%	To inquire	Tue 08 Apr 25
4,6-Difluoroindole-2-carboxylic acid REF: 3D-FD33923CAS: 247564-66-5	Min. 95%	- - -	Discontinued product