CAS 24784-69-8: 6-fluoro-9-(beta-D-ribofuranosyl)-9H-purine

Description:6-Fluoro-9-(beta-D-ribofuranosyl)-9H-purine, commonly known as fludarabine, is a synthetic nucleoside analog of adenosine. It features a purine base, specifically a modified adenine structure, with a fluorine atom at the 6-position and a ribofuranosyl sugar moiety. This compound is characterized by its ability to interfere with DNA synthesis and repair, making it particularly effective in the treatment of certain hematological malignancies, such as chronic lymphocytic leukemia and non-Hodgkin lymphoma. Fludarabine is typically administered intravenously and is known for its relatively low toxicity profile compared to traditional chemotherapeutic agents. Its mechanism of action involves the inhibition of DNA polymerase and ribonucleotide reductase, leading to the disruption of nucleotide metabolism and ultimately inducing apoptosis in rapidly dividing cells. Additionally, fludarabine's pharmacokinetics are influenced by factors such as renal function, and it is often used in combination with other agents to enhance therapeutic efficacy.

Formula:C₁₀H₁₁FN₄O₄

InChI:InChI=1/C10H11FN4O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2/t4-,6-,7-,10-/m1/s1