CAS 2489-77-2: Trimethylthiourea

Description:Trimethylthiourea is an organic compound characterized by its thiourea structure, where three methyl groups are attached to the nitrogen atom. It is typically a white crystalline solid that is soluble in water and various organic solvents. The compound has a molecular formula of C4H11N3S and features a thiocarbonyl group, which contributes to its reactivity and potential applications in various chemical processes. Trimethylthiourea is known for its use as a reagent in organic synthesis, particularly in the preparation of certain pharmaceuticals and agrochemicals. Additionally, it can act as a stabilizer in the formulation of certain materials and is studied for its biological properties, including potential antimicrobial activity. Due to its structure, it can participate in hydrogen bonding, influencing its solubility and interaction with other compounds. Safety data indicates that, while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed to minimize exposure.

Formula:C₄H₁₀N₂S

InChI:InChI=1S/C4H10N2S/c1-5-4(7)6(2)3/h1-3H3,(H,5,7)

InChI key:InChIKey=JAEZSIYNWDWMMN-UHFFFAOYSA-N

SMILES:S=C(NC)N(C)C

Synonyms:
1,1,3-Trimethylthiourea
1,3,3-Trimethylthiourea
N,N,N′-Trimethylthiourea
N1,1-dimethylhydrazine-1-carbothioamide
NSC 153385
Nocceler TMU
Sanceler TMU
Thiate E
Thiate EF 2
Thiourea, N,N,N′-trimethyl-
See more synonyms
Thiourea, trimethyl-
Trimethylthiourea
Urea, 1,1,3-trimethyl-2-thio-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Thiourea, N,N,N'-trimethyl- REF: IN-DA002PR6CAS: 2489-77-2	98%	35.00 €~157.00 €	Thu 27 Mar 25
Trimethylthiourea REF: 3B-T0667CAS: 2489-77-2	>98.0%(N)	52.00 €~144.00 €	Tue 01 Apr 25
Trimethylthiourea REF: 10-F175200CAS: 2489-77-2	98.0%	To inquire	Tue 08 Apr 25
1,3,3-Trimethylthiourea REF: 3D-CAA48977CAS: 2489-77-2	Min. 95%	- - -	Discontinued product