CAS 24909-72-6: oleic anhydride
Description:Oleic anhydride, with the CAS number 24909-72-6, is a chemical compound derived from oleic acid, a monounsaturated fatty acid. It is characterized by its anhydride structure, which typically involves the removal of water from two carboxylic acid groups, leading to a cyclic or linear anhydride form. Oleic anhydride is generally a colorless to pale yellow liquid with a characteristic fatty odor. It is soluble in organic solvents but has limited solubility in water. The compound is primarily used in the synthesis of surfactants, lubricants, and various chemical intermediates. Its reactivity is influenced by the presence of the anhydride functional group, making it useful in polymerization and esterification reactions. Additionally, oleic anhydride can exhibit properties such as low viscosity and a relatively high boiling point, which are advantageous in industrial applications. Safety considerations include handling it with care, as it may cause irritation upon contact with skin or eyes.
Formula:C36H66O3
InChI:InChI=1S/C36H66O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(37)39-36(38)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-34H2,1-2H3/b19-17-,20-18-
InChI key:InChIKey=OCNZHGHKKQOQCZ-CLFAGFIQSA-N
SMILES:O=C(OC(=O)CCCCCCCC=CCCCCCCCC)CCCCCCCC=CCCCCCCCC
- Synonyms:
- (9Z)-octadec-9-enoic anhydride
- 9-Octadecenoic acid (9Z)-, 1,1'-anhydride
- 9-Octadecenoic acid (9Z)-, anhydride
- 9-Octadecenoic acid (Z)-, anhydride
- Oleic acid anhydride
- Oleoyl anhydride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 9-Octadecenoic acid (9Z)-, 1,1'-anhydride REF: IN-DA002PTFCAS: 24909-72-6 | 95% | To inquire | Thu 27 Mar 25 |
![]() | Oleic Anhydride REF: 54-OR1014549CAS: 24909-72-6 | 95%+ | 195.00 € | Fri 28 Mar 25 |
![]() | Oleic anhydride REF: 7W-GL9071CAS: 24909-72-6 | - - - | To inquire | Fri 28 Mar 25 |
![]() | Oleic anhydride REF: 10-F986975CAS: 24909-72-6 | - - - | 122.00 €~417.00 € | Tue 01 Apr 25 |
![]() | Oleic anhydride REF: 3D-ZAA90972CAS: 24909-72-6 | Min. 95% | - - - | Discontinued product |

9-Octadecenoic acid (9Z)-, 1,1'-anhydride
Ref: IN-DA002PTF
1g | 51.00 € | ||
5g | 117.00 € | ||
25g | 330.00 € | ||
100g | To inquire | ||
250mg | 37.00 € |

Ref: 10-F986975
5g | 122.00 € | ||
25g | 417.00 € |

Oleic anhydride
Ref: 3D-ZAA90972
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
500mg | Discontinued | Request information |