CAS 249604-82-8: 5-Amino-3-hydroxy-2(1H)-quinolinone

Description: 5-Amino-3-hydroxy-2(1H)-quinolinone, with the CAS number 249604-82-8, is a heterocyclic organic compound characterized by a quinoline backbone. This compound features an amino group (-NH2) and a hydroxyl group (-OH) at specific positions on the quinoline ring, which contribute to its chemical reactivity and potential biological activity. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl group. The compound may exhibit various properties such as fluorescence, making it useful in biochemical applications. Its structure allows for potential interactions with biological targets, which has led to interest in its pharmacological properties, including antimicrobial and anticancer activities. The presence of both amino and hydroxyl functional groups enhances its ability to form hydrogen bonds, influencing its solubility and reactivity. Overall, 5-Amino-3-hydroxy-2(1H)-quinolinone is a compound of interest in medicinal chemistry and material science due to its unique structural features and potential applications.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c10-6-2-1-3-7-5(6)4-8(12)9(13)11-7/h1-4,12H,10H2,(H,11,13)

InChI key: InChIKey=IVUVZNXJJXPSTI-UHFFFAOYSA-N

SMILES: O=C1NC=2C=CC=C(N)C2C=C1O

Synonyms:

• 5-Amino-3-hydroxy-2(1H)-quinolinone
• 2(1H)-Quinolinone, 5-amino-3-hydroxy-

5-Amino-3-hydroxyquinolin-2(1H)-one

CAS: 249604-82-8

Versatile small molecule scaffold

• Formula: C₉H₈N₂O₂
• Purity: Min. 95%
• Molecular weight: 176.17 g/mol