CAS 25021-49-2: 4-(2-methyl-1,3-thiazol-4-yl)aniline
Description:4-(2-Methyl-1,3-thiazol-4-yl)aniline, with the CAS number 25021-49-2, is an organic compound characterized by its aromatic amine structure. It features a thiazole ring, which is a five-membered heterocyclic compound containing sulfur and nitrogen, attached to an aniline moiety. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the presence of the hydrophobic aromatic ring. The thiazole group can impart unique chemical reactivity, making it useful in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and usage, as aromatic amines can pose health risks. Overall, 4-(2-methyl-1,3-thiazol-4-yl)aniline is a compound of interest in organic synthesis and medicinal chemistry.
Formula:C10H10N2S
InChI:InChI=1/C10H10N2S/c1-7-12-10(6-13-7)8-2-4-9(11)5-3-8/h2-6H,11H2,1H3
- Synonyms:
- 2-Methyl-4-(para-aminophenyl)thiazole
- 4-(2-Methyl-1,3-Thiazol-4-Yl)Phenylamine
- Benzenamine, 4-(2-methyl-4-thiazolyl)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-(2-METHYL-1,3-THIAZOL-4-YL)ANILINE REF: IN-DA00BDKUCAS: 25021-49-2 | 95% | 48.00 €~217.00 € | Thu 27 Mar 25 |
 | 4-(2-Methyl-1,3-thiazol-4-yl)aniline REF: 54-OR4380CAS: 25021-49-2 | 98% | 52.00 €~318.00 € | Thu 03 Apr 25 |
 | 4-(2-Methyl-1,3-thiazol-4-yl)aniline REF: 10-F042206CAS: 25021-49-2 | 95.0% | To inquire | Tue 08 Apr 25 |
 | [4-(2-Methyl-1,3-thiazol-4-yl)phenyl]amine REF: 3D-FM132193CAS: 25021-49-2 | Min. 95% | - - - | Discontinued product |
4-(2-METHYL-1,3-THIAZOL-4-YL)ANILINE
Ref: IN-DA00BDKU
| 1g | 83.00 € | ||
| 100mg | 48.00 € | ||
| 250mg | 52.00 € |
4-(2-Methyl-1,3-thiazol-4-yl)aniline
Ref: 54-OR4380
| 1g | 111.00 € | ||
| 5g | 318.00 € | ||
| 250mg | 52.00 € |
4-(2-Methyl-1,3-thiazol-4-yl)aniline
Ref: 10-F042206
| 1g | 90.00 € |
![[4-(2-Methyl-1,3-thiazol-4-yl)phenyl]amine](https://static.cymitquimica.com/products/3D/thumb/FM132193.jpg)
[4-(2-Methyl-1,3-thiazol-4-yl)phenyl]amine
Ref: 3D-FM132193
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
