CAS 251327-01-2: Methyl (4R)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-cyclopentene-1-carboxylate

Description:Methyl (4R)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-cyclopentene-1-carboxylate, with the CAS number 251327-01-2, is an organic compound characterized by its unique structure that includes a cyclopentene ring, an amino group, and an ester functional group. This compound features a chiral center at the 4-position of the cyclopentene, which contributes to its stereochemistry and potential biological activity. The presence of the dimethylethoxycarbonyl group enhances its stability and solubility in organic solvents, making it suitable for various synthetic applications. Methyl esters, like this compound, are often used in organic synthesis and can serve as intermediates in the production of pharmaceuticals and agrochemicals. The compound's reactivity is influenced by the functional groups present, allowing for potential transformations such as hydrolysis or amine coupling. Overall, this substance exemplifies the complexity and versatility of organic molecules in chemical research and applications.

Formula:C₁₂H₁₉NO₄

InChI:InChI=1S/C12H19NO4/c1-12(2,3)17-11(15)13-9-6-5-8(7-9)10(14)16-4/h5,9H,6-7H2,1-4H3,(H,13,15)/t9-/m1/s1

InChI key:InChIKey=BPVUUOLKMLXVJR-SECBINFHSA-N

SMILES:O=C(OC(C)(C)C)NC1CC=C(C(=O)OC)C1

Synonyms:
1-Cyclopentene-1-carboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester, (4R)-
(R)-Methyl 4-[(tert-butoxycarbonyl)amino]cyclopent-1-enecarboxylate
Methyl (4R)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-cyclopentene-1-carboxylate