CAS 25198-45-2: (4-chlorobenzyl)hydrazine
Description:(4-Chlorobenzyl)hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a 4-chlorobenzyl moiety. Its molecular structure features a benzene ring substituted with a chlorine atom at the para position relative to the hydrazine group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in medicinal chemistry, particularly in the synthesis of various pharmaceuticals and agrochemicals. The presence of the hydrazine group imparts reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. Additionally, (4-chlorobenzyl)hydrazine may exhibit biological activity, making it of interest in research related to drug development. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures in laboratory settings. As with many hydrazine derivatives, it is important to consider its stability and reactivity under different conditions.
Formula:C7H9ClN2
InChI:InChI=1/C7H9ClN2/c8-7-3-1-6(2-4-7)5-10-9/h1-4,10H,5,9H2
- Synonyms:
- (4-Chlorophenyl)methylhydrazine
- Hydrazine, (4-chlorophenyl)methyl-
- [(4-Chlorophenyl)Methyl]Hydrazine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Hydrazine, [(4-chlorophenyl)methyl]- REF: IN-DA002QUDCAS: 25198-45-2 | - - - | To inquire | Mon 24 Mar 25 |
![]() | (4-Chlorobenzyl)hydrazine REF: 10-F218244CAS: 25198-45-2 | 95.0% | - - - | Discontinued product |
![]() | (4-Chlorobenzyl)hydrazine dihydrochloride REF: 3D-FC130642CAS: 25198-45-2 | Min. 95% | - - - | Discontinued product |

Ref: 10-F218244
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

(4-Chlorobenzyl)hydrazine dihydrochloride
Ref: 3D-FC130642
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |