CAS 25436-07-1: Acetic acid, 2,2,2-trichloro-, trimethylsilyl ester

Description:Acetic acid, 2,2,2-trichloro-, trimethylsilyl ester, commonly referred to as a trimethylsilyl (TMS) derivative of trichloroacetic acid, is an organosilicon compound characterized by its ester functional group. This compound features a trichloroacetyl moiety, which imparts significant reactivity due to the presence of three chlorine atoms, making it a potent electrophile. The trimethylsilyl group enhances the compound's stability and volatility, facilitating its use in various chemical reactions, particularly in organic synthesis and analytical chemistry. It is often employed as a derivatizing agent in gas chromatography and mass spectrometry, where it helps to improve the volatility and detectability of polar compounds. The presence of the TMS group also aids in protecting functional groups during synthetic transformations. Acetic acid, 2,2,2-trichloro-, trimethylsilyl ester is typically a colorless liquid with a characteristic odor and should be handled with care due to its potential toxicity and reactivity. Proper safety measures, including the use of personal protective equipment, are essential when working with this compound.

Formula:C₅H₉Cl₃O₂Si

InChI:InChI=1S/C5H9Cl3O2Si/c1-11(2,3)10-4(9)5(6,7)8/h1-3H3

InChI key:InChIKey=HAIZQIKYAKUOBN-UHFFFAOYSA-N

SMILES:O=C(O[Si](C)(C)C)C(Cl)(Cl)Cl