CAS 25462-17-3: 2-(hydroxymethyl)-2-methylpentyl isopropyl-carbamate
Description:2-(Hydroxymethyl)-2-methylpentyl isopropyl-carbamate, identified by its CAS number 25462-17-3, is an organic compound that belongs to the class of carbamates. This substance typically features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. The specific structure of this compound includes a branched alkyl chain, which contributes to its hydrophobic properties, while the hydroxymethyl group enhances its potential for hydrogen bonding. This compound may exhibit moderate solubility in polar solvents due to the presence of the hydroxymethyl group, while its hydrophobic characteristics may limit solubility in water. It is often used in various applications, including as a chemical intermediate in the synthesis of other compounds, and may also have potential uses in agricultural or pharmaceutical formulations. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C11H23NO3
InChI:InChI=1S/C11H23NO3/c1-5-6-11(4,7-13)8-15-10(14)12-9(2)3/h9,13H,5-8H2,1-4H3,(H,12,14)
InChI key:InChIKey=CYKYMRWEPMUFSS-UHFFFAOYSA-N
SMILES:O=C(OCC(C)(CO)CCC)NC(C)C
- Synonyms:
- 1,3-Propanediol, 2-methyl-2-propyl-, mono(isopropylcarbamate)
- 2-(Hydroxymethyl)-2-Methylpentyl Propan-2-Ylcarbamate
- 2-(Hydroxymethyl)-2-methylpentyl N-(1-methylethyl)carbamate
- 2-(Hydroxymethyl)-2-methylpentyl isopropylcarbamate
- 3-Hydroxy-2-methyl-2-propylpropyl N-(propan-2-yl)carbamate
- Carbamic acid, (1-methylethyl)-, 2-(hydroxymethyl)-2-methylpentyl ester
- Carbamic acid, N-(1-methylethyl)-, 2-(hydroxymethyl)-2-methylpentyl ester
- Carbamic acid, isopropyl-, 2-(hydroxymethyl)-2-methylpentyl ester
- N-isoproply-2-methyl-2-proply-3-idrossipropyl carbamate
