CAS 25597-16-4: Ethyl (2E)-4,4,4-trifluoro-2-butenoate
Description:Ethyl (2E)-4,4,4-trifluoro-2-butenoate is an organic compound characterized by its unique trifluoromethyl group and an ester functional group. It features a butenoate backbone, which includes a double bond between the second and third carbon atoms, contributing to its reactivity and potential applications in organic synthesis. The presence of three fluorine atoms on the fourth carbon enhances the compound's lipophilicity and stability, making it of interest in various chemical reactions, including nucleophilic substitutions and polymerizations. This compound is typically a colorless liquid at room temperature and may have a distinctive odor. Its properties, such as boiling point, melting point, and solubility, are influenced by the fluorinated substituents, which can also impart unique characteristics like increased electronegativity and altered intermolecular interactions. Ethyl (2E)-4,4,4-trifluoro-2-butenoate is utilized in the synthesis of pharmaceuticals and agrochemicals, showcasing its importance in both industrial and research applications. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit specific hazards.
Formula:C6H7F3O2
InChI:InChI=1S/C6H7F3O2/c1-2-11-5(10)3-4-6(7,8)9/h3-4H,2H2,1H3/b4-3+
InChI key:InChIKey=ZKRJCMKLCDWROR-ONEGZZNKSA-N
SMILES:O=C(OCC)C=CC(F)(F)F
- Synonyms:
- (E)-Ethyl 4,4,4-trifluorobut-2-enoate
- 2-Butenoic acid, 4,4,4-trifluoro-, ethyl ester, (2E)-
- 2-Butenoic acid, 4,4,4-trifluoro-, ethyl ester, (E)-
- 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Pentadecafluorodecan-1-Ol
- Ethyl (2E)-4,4,4-trifluoro-2-butenoate
- Ethyl (E)-4,4,4-trifluorocrotonate
- Ethyl 4,4,4-trifluorocrotonate
- Ethyl trans-4,4,4-trifluoro-2-butenoate
- Ethyl trans-4,4,4-trifluorocrotonate
- ethyl (2E)-4,4,4-trifluorobut-2-enoate
- See more synonyms
