CAS 256519-11-6: 2-chloro-4-fluoro-1H-benzimidazole

Description:2-Chloro-4-fluoro-1H-benzimidazole is a heterocyclic organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. The presence of chlorine and fluorine substituents at the 2 and 4 positions, respectively, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. Its molecular structure allows for potential interactions with biological targets, making it of interest in pharmaceutical research. The chlorine and fluorine atoms can influence the compound's electronic properties, stability, and lipophilicity, which are critical factors in drug design. Additionally, 2-chloro-4-fluoro-1H-benzimidazole may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.

Formula:C₇H₄ClFN₂

InChI:InChI=1/C7H4ClFN2/c8-7-10-5-3-1-2-4(9)6(5)11-7/h1-3H,(H,10,11)

Synonyms:
1H-benzimidazole, 2-chloro-4-fluoro-
2-chloro-4-fluoro-1H-benzo[d]imidazole

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1H-Benzimidazole,2-chloro-4-fluoro-(9CI) REF: IN-DA00BG36CAS: 256519-11-6	96%	101.00 €~272.00 €	Thu 27 Mar 25
2-Chloro-4-fluoro-1H-benzimidazole REF: 54-PC501474CAS: 256519-11-6	By hplc: 98.3% by area (Typical Value in Batch COA)	100.00 €~667.00 €	Fri 28 Mar 25
2-Chloro-4-fluoro-1H-benzo[d]imidazole REF: 10-F077457CAS: 256519-11-6	95.0%	To inquire	Tue 08 Apr 25
2-chloro-4-fluoro-1h-benzimidazole REF: 3D-FC104862CAS: 256519-11-6	Min. 95%	- - -	Discontinued product