CAS 25694-16-0: ethyl cyano(tricyclo[3.3.1.1~3,7~]dec-2-yl)acetate

Description:Ethyl cyano(tricyclo[3.3.1.1^3,7]dec-2-yl)acetate, with the CAS number 25694-16-0, is a chemical compound characterized by its unique bicyclic structure, which includes a tricyclic decane framework. This compound features an ethyl ester functional group and a cyano group, contributing to its reactivity and potential applications in organic synthesis. The presence of the cyano group typically imparts polar characteristics, enhancing solubility in polar solvents. The tricyclic structure can influence the compound's physical properties, such as boiling and melting points, as well as its stability and reactivity. Ethyl cyano(tricyclo[3.3.1.1^3,7]dec-2-yl)acetate may be utilized in various chemical reactions, including nucleophilic additions and as an intermediate in the synthesis of more complex organic molecules. Its specific applications and behavior in reactions would depend on the surrounding conditions and the presence of other reactants. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the realm of cyclic compounds.

Formula:C₁₅H₂₁NO₂

InChI:InChI=1/C15H21NO2/c1-2-18-15(17)13(8-16)14-11-4-9-3-10(6-11)7-12(14)5-9/h9-14H,2-7H2,1H3

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Ethyl 2-(adamantan-2-ylidene)-2-cyanoacetate REF: 10-F653283CAS: 25694-16-0	95%	- - -	Discontinued product
	Adamantaneacetic acid REF: 3D-ABA69416CAS: 25694-16-0	Min. 95%	- - -	Discontinued product