CAS 25753-26-8: 2,4,6-Tris(trifluoromethyl)benzoic acid

Description:2,4,6-Tris(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of three trifluoromethyl groups attached to the benzene ring at the 2, 4, and 6 positions. This compound is notable for its high electronegativity due to the trifluoromethyl groups, which significantly influence its chemical behavior, making it a strong acid compared to other benzoic acids. The presence of these groups also enhances its lipophilicity and thermal stability, which can affect its solubility in various solvents. 2,4,6-Tris(trifluoromethyl)benzoic acid is often used in organic synthesis and materials science, particularly in the development of fluorinated compounds and polymers. Its unique properties make it a subject of interest in research related to pharmaceuticals and agrochemicals. Additionally, the compound's structure allows for potential applications in the field of fluorinated materials, where its characteristics can be exploited for specific functionalities. Safety precautions should be observed when handling this compound due to its potential environmental and health impacts.

Formula:C₁₀H₃F₉O₂

InChI:InChI=1S/C10H3F9O2/c11-8(12,13)3-1-4(9(14,15)16)6(7(20)21)5(2-3)10(17,18)19/h1-2H,(H,20,21)

InChI key:InChIKey=AQXAOQFYVRCSBV-UHFFFAOYSA-N

SMILES:O=C(O)C=1C(=CC(=CC1C(F)(F)F)C(F)(F)F)C(F)(F)F

Synonyms:
2,4,6-Tris(trifluoromethyl)benzoic acid
2,4,6-Tris(trifluoromethyl)benzoicacid
Benzoic acid, 2,4,6-tris(trifluoromethyl)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2,4,6-TRIS(TRIFLUOROMETHYL)BENZOIC ACID REF: IN-DA00BD70CAS: 25753-26-8	98%	164.00 €~265.00 €	Thu 27 Mar 25
2,4,6-Tris(trifluoromethyl)benzoic acid REF: 10-F065861CAS: 25753-26-8	97.0%	To inquire	Tue 08 Apr 25
2,4,6-Tris(Trifluoromethyl)Benzoic Acid REF: 3D-FT84847CAS: 25753-26-8	Min. 95%	- - -	Discontinued product