CAS 259824-62-9: 2-Propenal, (4,6-dinitrophenyl-2,3,5-d3)hydrazone

Description:2-Propenal, (4,6-dinitrophenyl-2,3,5-d3)hydrazone is a chemical compound characterized by its hydrazone functional group, which is formed from the reaction of 2-propenal (an unsaturated aldehyde) and a hydrazine derivative containing a 4,6-dinitrophenyl group. This compound is notable for its isotopic labeling, indicated by the presence of deuterium (D) at specific positions on the phenyl ring, which can be useful in studies involving reaction mechanisms or tracking the fate of the molecule in various chemical processes. The presence of the dinitrophenyl group contributes to the compound's stability and reactivity, making it a potential candidate for applications in organic synthesis and analytical chemistry. Additionally, the compound may exhibit distinct spectroscopic properties due to the dinitrophenyl moiety, which can be leveraged for identification and characterization purposes. Overall, this compound is of interest in both academic research and industrial applications, particularly in the fields of organic chemistry and materials science.

Formula:C₉H₅D₃N₄O₄

InChI:InChI=1S/C9H8N4O4/c1-2-5-10-11-8-4-3-7(12(14)15)6-9(8)13(16)17/h2-6,11H,1H2/i3D,4D,6D

InChI key:InChIKey=JJPZHGIYUVFTGG-VSWDYIGLSA-N

SMILES:O=N(=O)C1=CC=C(NN=CC=C)C(=C1)N(=O)=O

Synonyms:
2-Propenal, (4,6-dinitrophenyl-2,3,5-d3)hydrazone

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Acrolein 2,4-Dinitrophenylhydrazone-3,5,6-d3 REF: 3U-D7601CAS: 259824-62-9	99 atom % D	335.00 €~549.00 €	Mon 31 Mar 25
Acrolein 2,4-Dinitrophenylhydrazone-d3 REF: TR-A191222CAS: 259824-62-9	- - -	350.00 €~2,202.00 €	Tue 08 Apr 25
Acrolein 2,4-dinitrophenylhydrazone-d3 REF: 3D-JKA82462CAS: 259824-62-9	Min. 95%	- - -	Discontinued product