CAS 26048-94-2: benzyl {(2S)-1-[(benzyloxy)amino]-3-hydroxy-1-oxopropan-2-yl}carbamate
Description:Benzyl {(2S)-1-[(benzyloxy)amino]-3-hydroxy-1-oxopropan-2-yl}carbamate, with the CAS number 26048-94-2, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a benzyloxy moiety. This compound is typically classified as an amino acid derivative due to the presence of an amino group and a hydroxyl group, which contribute to its potential biological activity. It is often used in biochemical research and pharmaceutical applications, particularly in the synthesis of peptide-based drugs or as a building block in organic synthesis. The presence of the benzyl groups enhances its lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the stereochemistry indicated by the (2S) configuration suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structural features and functional groups contribute to its potential utility in various chemical and biological applications.
Formula:C18H20N2O5
InChI:InChI=1/C18H20N2O5/c21-11-16(17(22)20-25-13-15-9-5-2-6-10-15)19-18(23)24-12-14-7-3-1-4-8-14/h1-10,16,21H,11-13H2,(H,19,23)(H,20,22)/t16-/m0/s1

Carbamic acid, N-[(1S)-1-(hydroxymethyl)-2-oxo-2-[(phenylmethoxy)amino]ethyl]-, phenylmethyl ester
Ref: IN-DA002RIH
Undefined size | To inquire |

(S)-[1-[(Benzyloxy)carbamoyl]-2-hydroxyethyl]carbamic acid benzyl ester
Ref: 7W-GM5929
Undefined size | To inquire |