CAS 26117-28-2: N-Acetyl-D-cysteine
Description:N-Acetyl-D-cysteine (NAC) is a derivative of the amino acid cysteine, characterized by the addition of an acetyl group to the nitrogen atom of the cysteine molecule. It is a white to off-white crystalline powder that is soluble in water and has a slightly bitter taste. NAC is known for its antioxidant properties, primarily due to its ability to replenish intracellular levels of glutathione, a vital antioxidant in the body. It is commonly used in clinical settings as a mucolytic agent to help break down mucus in respiratory conditions and as an antidote for acetaminophen overdose. Additionally, NAC has been studied for its potential benefits in various health conditions, including psychiatric disorders, chronic obstructive pulmonary disease (COPD), and liver health. Its safety profile is generally favorable, although some individuals may experience gastrointestinal side effects. As a supplement, NAC is often marketed for its purported benefits in enhancing detoxification and supporting overall health.
Formula:C5H9NO3S
InChI:InChI=1/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m1/s1
InChI key:InChIKey=PWKSKIMOESPYIA-SCSAIBSYSA-N
SMILES:O=C(O)C(NC(=O)C)CS
