CAS 2613-27-6: (OC-6-21)-Pentafluoro(4-nitrophenyl)sulfur
Description:(OC-6-21)-Pentafluoro(4-nitrophenyl)sulfur, with the CAS number 2613-27-6, is a specialized chemical compound that features a sulfur atom bonded to a pentafluorophenyl group and a nitro-substituted aromatic ring. This compound is characterized by its high electronegativity due to the presence of multiple fluorine atoms, which significantly influences its reactivity and stability. The nitro group (-NO2) attached to the phenyl ring enhances the compound's electron-withdrawing properties, making it useful in various chemical applications, including as a reagent in organic synthesis and in materials science. The presence of fluorine atoms contributes to its unique physical properties, such as increased thermal stability and potential hydrophobic characteristics. Additionally, the compound may exhibit interesting electronic properties, making it a subject of study in fields like medicinal chemistry and materials development. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.
Formula:C6H4F5NO2S
InChI:InChI=1S/C6H4F5NO2S/c7-15(8,9,10,11)6-3-1-5(2-4-6)12(13)14/h1-4H
InChI key:InChIKey=AGNCKMHGYZKMLN-UHFFFAOYSA-N
SMILES:O=N(=O)C1=CC=C(C=C1)S(F)(F)(F)(F)F
- Synonyms:
- (OC-6-21)-Pentafluoro(4-nitrophenyl)sulfur
- (p-Nitrophenyl)sulfur pentafluoride
- 1-Nitro-4-(Pentafluoro-Lambda~6~-Sulfanyl)Benzene
- 1-Nitro-4-(pentafluorosulfanyl)benzene
- 4-(Pentafluorosulfanyl)-1-nitrobenzene
- 4-Nitro(pentafluorosulfanyl)benzene
- 4-Nitrobenzenesulfur pentafluoride
- 4-Nitrobenzenesulphur pentafluoride
- 4-Nitrophenylsulfur pentafluoride
- Pentafluoro(4-nitrophenyl)sulfur
- See more synonyms
- Sulfur, pentafluoro(4-nitrophenyl)-, (OC-6-21)-
- Sulfur, pentafluoro(p-nitrophenyl)-

4-Nitrophenylsulfur Pentafluoride
Ref: 3B-N0743
1g | 58.00 € | ||
5g | 162.00 € |

Sulfur, pentafluoro(4-nitrophenyl)-, (OC-6-21)-
Ref: IN-DA002RSM
100mg | 46.00 € | ||
250mg | 64.00 € |

4-Nitrophenylsulphur pentafluoride
Ref: 54-PC8766
1g | 383.00 € | ||
5g | 1,111.00 € | ||
25g | 3,447.00 € |

4-Nitrophenylsulfur pentafluoride
Ref: 10-F008100
25g | To inquire |

(Oc-6-21)-Pentafluoro(4-Nitrophenyl)-Sulfur
Ref: 3D-FO87550
2g | 331.00 € | ||
5g | 511.00 € |