CAS 26131-61-3: 4-ethyl-5-phenyl-4H-1,2,4-triazole-3-thiol
Description:4-Ethyl-5-phenyl-4H-1,2,4-triazole-3-thiol, with the CAS number 26131-61-3, is a heterocyclic compound characterized by the presence of a triazole ring, which is a five-membered ring containing three nitrogen atoms. This compound features an ethyl group and a phenyl group, contributing to its unique chemical properties and potential applications. The thiol (-SH) functional group is significant, as it can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. The presence of both the triazole and thiol functionalities suggests potential biological activity, making it of interest in pharmaceutical and agricultural chemistry. Additionally, compounds of this nature may exhibit properties such as antimicrobial, antifungal, or herbicidal activities. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 4-ethyl-5-phenyl-4H-1,2,4-triazole-3-thiol is a versatile compound with potential applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C10H11N3S
InChI:InChI=1/C10H11N3S/c1-2-13-9(11-12-10(13)14)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,12,14)
- Synonyms:
- 3H-1,2,4-Triazole-3-thione, 4-ethyl-2,4-dihydro-5-phenyl-
- 4-Ethyl-5-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
- 4H-1,2,4-Triazole-3-thiol, 4-ethyl-5-phenyl-
- 4-Ethyl-5-phenyl-4H-1,2,4-triazole-3-thiol
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3H-1,2,4-Triazole-3-thione, 4-ethyl-2,4-dihydro-5-phenyl- REF: IN-DA002RTCCAS: 26131-61-3 | 95% | 111.00 €~538.00 € | Thu 27 Mar 25 |
 | 4-Ethyl-5-phenyl-4H-1,2,4-triazole-3-thiol REF: 54-OR14450CAS: 26131-61-3 | - - - | 89.00 €~1,023.00 € | Thu 03 Apr 25 |
 | 4-Ethyl-5-phenyl-4 H -[1,2,4]triazole-3-thiol REF: 10-F031762CAS: 26131-61-3 | 95.0% | - - - | Discontinued product |
 | 4-Ethyl-5-phenyl-4H-1,2,4-triazole-3-thiol REF: 3D-FE114807CAS: 26131-61-3 | Min. 95% | - - - | Discontinued product |
3H-1,2,4-Triazole-3-thione, 4-ethyl-2,4-dihydro-5-phenyl-
Ref: IN-DA002RTC
| 1g | 210.00 € | ||
| 5g | 538.00 € | ||
| 250mg | 111.00 € |
Ref: 54-OR14450
| 1g | 389.00 € | ||
| 5g | 1,023.00 € | ||
| 250mg | 162.00 € |
![4-Ethyl-5-phenyl-4 H -[1,2,4]triazole-3-thiol](https://static.cymitquimica.com/products/10/thumb/F031762.jpg)
4-Ethyl-5-phenyl-4 H -[1,2,4]triazole-3-thiol
Ref: 10-F031762
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 2.5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
4-Ethyl-5-phenyl-4H-1,2,4-triazole-3-thiol
Ref: 3D-FE114807
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
