CAS 261762-97-4: 5-Chloro-2-fluorobenzeneacetic acid

Description:5-Chloro-2-fluorobenzeneacetic acid is an aromatic carboxylic acid characterized by the presence of both chlorine and fluorine substituents on a benzene ring. The compound features a chloro group at the 5-position and a fluoro group at the 2-position relative to the carboxylic acid functional group. This substitution pattern can influence its chemical reactivity, solubility, and biological activity. Typically, compounds like this exhibit moderate polarity due to the carboxylic acid group, which can engage in hydrogen bonding, enhancing solubility in polar solvents. The presence of halogens can also affect the compound's electronic properties, potentially making it more reactive in electrophilic aromatic substitution reactions. Additionally, 5-Chloro-2-fluorobenzeneacetic acid may have applications in pharmaceuticals or agrochemicals, where such halogenated aromatic compounds are often utilized for their unique properties. Safety and handling considerations should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.

Formula:C₈H₆ClFO₂

InChI:InChI=1S/C8H6ClFO2/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3H,4H2,(H,11,12)

InChI key:InChIKey=NOKLOLLCDCEFAK-UHFFFAOYSA-N

SMILES:O=C(O)CC1=CC(Cl)=CC=C1F

Synonyms:
(5-Chloro-2-fluorophenyl)acetic acid
(5-Chloro-2-fluorophenyl)aceticacid
2-(5-Chloro-2-fluorophenyl)acetic acid
2-Fluoro-5-chlorophenylacetic acid
5-Chloro-2-fluorobenzeneacetic acid
5-Chloro-2-fluorophenylacetic acid
Benzeneacetic acid, 5-chloro-2-fluoro-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzeneacetic acid, 5-chloro-2-fluoro- REF: IN-DA002S1VCAS: 261762-97-4	97%	26.00 €~490.00 €	Thu 27 Mar 25
5-Chloro-2-fluorophenylacetic acid REF: 54-PC0135CAS: 261762-97-4	98%	32.00 €~59.00 €	Fri 28 Mar 25
5-Chloro-2-fluorophenylacetic acid REF: 10-F005667CAS: 261762-97-4	95.0%	24.00 €~460.00 €	Tue 01 Apr 25
5-Chloro-2-fluorophenylacetic acid REF: 3D-FC63968CAS: 261762-97-4	Min. 95%	- - -	Discontinued product