CAS 261951-91-1: 2-Methyl-4-(trifluoromethoxy)benzoic acid

Description:2-Methyl-4-(trifluoromethoxy)benzoic acid is an aromatic carboxylic acid characterized by the presence of a methyl group and a trifluoromethoxy group attached to a benzoic acid framework. The trifluoromethoxy group, which consists of a carbon atom bonded to three fluorine atoms and an oxygen atom, imparts unique electronic and steric properties to the molecule, enhancing its lipophilicity and potentially influencing its reactivity and solubility. This compound typically exhibits acidic behavior due to the carboxylic acid functional group, allowing it to donate protons in solution. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the presence of fluorine atoms often enhances the stability and bioactivity of compounds, making them of interest in drug design. The compound's physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Overall, 2-Methyl-4-(trifluoromethoxy)benzoic acid is a versatile compound with significant implications in various chemical fields.

Formula:C₉H₇F₃O₃

InChI:InChI=1S/C9H7F3O3/c1-5-4-6(15-9(10,11)12)2-3-7(5)8(13)14/h2-4H,1H3,(H,13,14)

InChI key:InChIKey=GINWJGHZNRKJEK-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC=C(OC(F)(F)F)C=C1C

Synonyms:
2-Methyl-4-(trifluoromethoxy)benzoic acid
Benzoic acid, 2-methyl-4-(trifluoromethoxy)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzoic acid, 2-methyl-4-(trifluoromethoxy)- REF: IN-DA002S6ACAS: 261951-91-1	95%	To inquire	Thu 27 Mar 25
2-Methyl-4-(trifluoromethoxy)benzoic acid REF: 54-PC0416CAS: 261951-91-1	97%	94.00 €~316.00 €	Fri 28 Mar 25
2-Methyl-4-(trifluoromethoxy)benzoic acid REF: 10-F334439CAS: 261951-91-1	95.0%	87.00 €~1,364.00 €	Tue 01 Apr 25
2-Methyl-4-(trifluoromethoxy)benzoic acid REF: 3D-LKA95191CAS: 261951-91-1	Min. 95%	To inquire	Thu 08 May 25