CAS 26220-72-4: (SP-4-1)-[Bis[μ-[[2,3-butanedione 2,3-di(oximato-κO)](2-)]]tetrafluorodiborato(2-)-κN,κN′,κN′′,κN′′′]cobalt
Description:The chemical substance known as "(SP-4-1)-[Bis[μ-[[2,3-butanedione 2,3-di(oximato-κO)](2-)]]tetrafluorodiborato(2-)-κN,κN′,κN′′,κN′′′]cobalt," with the CAS number 26220-72-4, is a coordination complex featuring cobalt as the central metal ion. This compound is characterized by its coordination with a unique ligand system derived from 2,3-butanedione oxime, which forms chelate rings with the cobalt center. The presence of tetrafluorodiborate groups indicates a strong electron-withdrawing effect, which can influence the electronic properties and reactivity of the complex. The oxime functional groups contribute to the overall stability and solubility of the compound in various solvents. Additionally, the stereochemistry of the complex is significant, as it can affect its biological activity and interaction with other molecules. Overall, this compound exemplifies the intricate interplay between metal ions and organic ligands in coordination chemistry, showcasing potential applications in catalysis, materials science, and medicinal chemistry.
Formula:C8H12B2CoF4N4O4
InChI:InChI=1S/C8H12B2F4N4O4.Co/c1-5-6(2)16-20-10(13,14)22-18-8(4)7(3)17-21-9(11,12)19-15-5;/h1-4H3;/q-2;+2
InChI key:InChIKey=YINFEBLKZZBOEG-UHFFFAOYSA-N
SMILES:[F-][B+3]1([F-])[O-][N]2=C(C(=[N]3[O-][B+3]([F-])([F-])[O-][N]4=C(C(=[N]([O-]1)[Co+2]234)C)C)C)C
- Synonyms:
- Cobaltate(1-), [[bis[μ-[2,3-butanedione dioximato(2-)]]tetrafluorodiborato](2-)]-
- Cobalt, [bis[μ-[(2,3-butanedione dioximato)(2-)-O:O′]]tetrafluorodiborato(2-)-N,N′,N′′,N′′′]-, (SP-4-1)-
- Cobalt, [bis[μ-[[2,3-butanedione 2,3-di(oximato-κO)](2-)]]tetrafluorodiborato(2-)-κN,κN′,κN′′,κN′′′]-, (SP-4-1)-
- Borate(2-), bis[μ-[(2,3-butanedione dioximato)(2-)-O:O′]]tetrafluorodi-, cobalt complex
- Cobalt, [bis[μ-[[2,3-butanedione di(oximato-κO)](2-)]]tetrafluorodiborato(2-)-κN,κN′,κN′′,κN′′′]-, (SP-4-1)-

N,N',N,N'-(Tetrafluorodiborato)bis[μ-(2,3-butanedionedioximato)]cobalt(II) dihydrate, min. 98%
Ref: 08-27-1965
100mg | 111.00 € | ||
500mg | 396.00 € |

N,N',N",N"'-(Tetrafluorodiborato) bis[μ-(2,3-butanedionedioxiMato)]cobalt(II)
Ref: IN-DA00C3A3
1g | 321.00 € | ||
5g | To inquire | ||
50mg | 103.00 € | ||
100mg | 116.00 € | ||
250mg | 177.00 € |