CAS 2627-95-4: 1,3-Diethenyl-1,1,3,3-tetramethyldisiloxane
Description:1,3-Diethenyl-1,1,3,3-tetramethyldisiloxane, with CAS number 2627-95-4, is a siloxane compound characterized by its unique structure that includes a siloxane backbone and vinyl groups. This compound typically exhibits properties such as low viscosity and volatility, making it useful in various applications, including as a silicone intermediate in polymer synthesis. The presence of vinyl groups allows for further chemical reactivity, particularly in addition reactions, which can facilitate the formation of cross-linked silicone networks. Additionally, the tetramethyl groups contribute to the compound's hydrophobic characteristics, enhancing its stability and resistance to moisture. It is generally considered to have low toxicity, but like many siloxanes, it should be handled with care to avoid environmental release. Overall, 1,3-Diethenyl-1,1,3,3-tetramethyldisiloxane is valued in the chemical industry for its versatility and functional properties in silicone-based formulations.
Formula:C8H18OSi2
InChI:InChI=1S/C8H18OSi2/c1-7-10(3,4)9-11(5,6)8-2/h7-8H,1-2H2,3-6H3
InChI key:InChIKey=BITPLIXHRASDQB-UHFFFAOYSA-N
SMILES:O([Si](C=C)(C)C)[Si](C=C)(C)C
- Synonyms:
- 1,1,3,3-Tetramethyl-1,3-divinyldisiloxane
- 1,1′-Divinyltetramethyldisiloxane
- 1,3-Divinyl-1,1,3,3-tetramethyldisiloxane
- 1,3-Divinyltetramethyldisiloxane
- Andisil 2827-186L
- Bis(ethenyldimethylsilyl) ether
- Disiloxane, 1,1,3,3-tetramethyl-1,3-divinyl-
- Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethyl-
- Divinyltetramethyldisiloxane
- Dp 162
- See more synonyms
- Dvtmdso
- Ls 7250
- Lullaby DJ 030
- Ply 70
- Sid 4613.0
- Tetramethyl-1,3-divinyldisiloxane
- Tetramethyldivinylsiloxane
- Vinyldimethylsilyl ether
- sym-Divinyltetramethyldisiloxane
- sym-Tetramethyldivinyldisiloxane