CAS 2646-35-7: Sedoheptulose, 7-phosphate

Description:Sedoheptulose 7-phosphate is a phosphorylated sugar molecule that plays a significant role in various metabolic pathways, particularly in the pentose phosphate pathway and the Calvin cycle in plants. It is a seven-carbon sugar (heptose) with a phosphate group attached to the seventh carbon, which is crucial for its biochemical functions. This compound is involved in the synthesis of ribulose bisphosphate, a key molecule in carbon fixation during photosynthesis. Sedoheptulose 7-phosphate is also important in the regulation of metabolic processes, influencing the balance between carbohydrate metabolism and energy production. Its structure allows it to participate in various enzymatic reactions, making it a vital intermediate in cellular metabolism. The compound is typically found in biological systems and can be synthesized in the laboratory for research purposes. Its CAS number, 2646-35-7, is used for identification in chemical databases and regulatory contexts. Overall, sedoheptulose 7-phosphate is essential for understanding metabolic pathways in both plants and microorganisms.

Formula:C₇H₁₅O₁₀P

InChI:InChI=1S/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1

InChI key:InChIKey=JDTUMPKOJBQPKX-GBNDHIKLSA-N

SMILES:O=C(CO)C(O)C(O)C(O)C(O)COP(=O)(O)O

Synonyms:
Sedoheptulose, 7-(dihydrogen phosphate)
Sedoheptulose, 7-phosphate
D-altro-2-Heptulose, 7-(dihydrogen phosphate)

Found 3 products.

Product data	Purity	Price range	Estimated delivery
D-Sedoheptulose 7-phosphate REF: TM-T19268CAS: 2646-35-7	98%	To inquire	Fri 28 Mar 25
D-Sedoheptulose-7-phosphate lithium salt REF: 7W-GC4355CAS: 2646-35-7	- - -	To inquire	Fri 28 Mar 25
D-Sedoheptulose 7-phosphate lithium REF: 3D-MS139007CAS: 2646-35-7	Min. 95%	423.00 €~1,296.00 €	Mon 07 Apr 25