CAS 26628-47-7: 9-(Diethylamino)spiro[12H-benzo[a]xanthene-12,1′(3′H)-isobenzofuran]-3′-one
Description:9-(Diethylamino)spiro[12H-benzo[a]xanthene-12,1′(3′H)-isobenzofuran]-3′-one, with CAS number 26628-47-7, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a spiro linkage between a benzo[a]xanthene and an isobenzofuran moiety. This compound typically exhibits strong fluorescence properties, making it of interest in various applications such as fluorescent dyes, sensors, and potentially in biological imaging. The presence of the diethylamino group enhances its solubility in organic solvents and may influence its electronic properties, contributing to its photophysical behavior. Additionally, the compound may display unique chemical reactivity due to its conjugated system, which can be exploited in organic synthesis or material science. Its stability and reactivity can vary depending on environmental conditions such as pH and solvent polarity. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential applications in various fields, including materials science and biochemistry.
Formula:C28H23NO3
InChI:InChI=1S/C28H23NO3/c1-3-29(4-2)19-14-15-23-25(17-19)31-24-16-13-18-9-5-6-10-20(18)26(24)28(23)22-12-8-7-11-21(22)27(30)32-28/h5-17H,3-4H2,1-2H3
InChI key:InChIKey=HMNGPLGXLQFPFN-UHFFFAOYSA-N
SMILES:O=C1OC2(C3=CC=C(C=C3OC=4C=CC=5C=CC=CC5C42)N(CC)CC)C=6C=CC=CC16
- Synonyms:
- 1'(3'H)-Isobenzofuran]-3'-One,9-(Diethylamino)-Spiro[12H-Benzo[A]Xanthene-1
- 1'(3'H)-isobenzofuran]-3'-one,9-(diethylamino)-Spiro[12H-benzo[a]xanthene-12
- 1,2-Benz-6-diethylaminofluorane
- 1,2-Benzo-6-diethylaminofluorane
- 3-(Diethylamino)-7,8-benzofluoran
- 3-Diethylamino-7,8-benzo[α]fluoran
- 3-Diethylaminobenzo[a]fluoran
- 3-Diethylaminobenzo[a]fluoran Spiro [isobenzofuran-1(3H),12'-[12H]benzo [a] xanthene]-9'-diethylamino-3-one
- 6'-(Diethylamino)-1',2'-Benzofluoran
- 6-Diethylamino-1,2-benzofluoran
- See more synonyms
- 9'-(diethylamino)-3H-spiro[2-benzofuran-1,12'-benzo[a]xanthen]-3-one
- 9-(Diethylamino)spiro[12H-benzo[a]xanthene-12,1′(3′H)-isobenzofuran]-3′-one
- 9-(Diethylamino)spiro[12H-benzo[a]xanthene-12,1′-phthalide]
- Color Former Red 3
- Copikem 747
- Psd-P
- Red DCF
- Red-DCH
- Spiro [isobenzofuran-1(3H), 12'-[12H]benzo [a] xanthene]-9'-diethylamino-3-one
- Spiro[12H-benzo[a]xanthene-12,1'(3'H)-isobenzofuran]-3'-one,9-(diethylamino)-
- Spiro[12H-benzo[a]xanthene-12,1′(3′H)-isobenzofuran]-3′-one, 9-(diethylamino)-
- Spiro[12H-benzo[a]xanthene-12,1′-phthalan]-3′-one, 9-(diethylamino)-
- Yamamoto Red 3
- 9-(diethylamino)-Spiro[12H-benzo[a]xanthene-12,1'(3'H)-isobenzofuran]-3'-one

Spiro[12H-benzo[a]xanthene-12,1'(3'H)-isobenzofuran]-3'-one, 9-(diethylamino)-
Ref: IN-DA002TVQ
5g | 72.00 € | ||
25g | 169.00 € |

9-(Diethylamino)-3'H-spiro[benzo[a]xanthene-12,1'-isobenzofuran]-3'-one
Ref: 10-F722339
5g | To inquire |

6'-(Diethylamino)-1',2'-benzofluoran
Ref: 3D-FD62568
25g | 344.00 € | ||
50g | 375.00 € | ||
100g | 607.00 € |