CAS 26725-51-9: 4-Hydroxybenzotriazole
Description:4-Hydroxybenzotriazole (CAS 26725-51-9) is an organic compound that belongs to the class of benzotriazoles, characterized by its triazole ring fused to a benzene ring with a hydroxyl group at the para position. This compound is typically a white to light yellow crystalline solid, exhibiting good solubility in polar solvents such as water, methanol, and ethanol. It is known for its ability to act as a UV stabilizer and is commonly used in various applications, including plastics, coatings, and adhesives, to prevent degradation from ultraviolet light exposure. Additionally, 4-Hydroxybenzotriazole serves as a corrosion inhibitor and is utilized in the synthesis of other chemical compounds. Its structure allows it to effectively absorb UV radiation, thereby protecting materials from photodegradation. The compound is generally considered to have low toxicity, but safety precautions should be taken when handling it, as with any chemical substance. Overall, 4-Hydroxybenzotriazole is valued for its protective properties in numerous industrial applications.
Formula:C6H5N3O
InChI:InChI=1S/C6H5N3O/c10-5-3-1-2-4-6(5)8-9-7-4/h1-3,10H,(H,7,8,9)
InChI key:InChIKey=JMTMSDXUXJISAY-UHFFFAOYSA-N
SMILES:OC1=CC=CC=2N=NNC12
- Synonyms:
- 1H-1,2,3-Benzotriazol-7-ol
- 1H-1,2,3-benzotriazol-4-ol
- 1H-Benzotriazol-4-ol
- 1H-Benzotriazol-7-ol
- 2H-1,2,3-Benzotriazol-4-ol
- 4-Hydroxy-1H-benzotriazole
- Benzotriazol-4-ol
![1H-Benzo[d][1,2,3]triazol-4-ol](https://static.cymitquimica.com/products/IN/thumb/DA003LJ8.jpg)
![1H-Benzo[d][1,2,3]triazol-7-ol](https://static.cymitquimica.com/products/54/thumb/OR84287.jpg)
