CAS 2675-79-8: 5-bromo-1,2,3-trimethoxybenzene
Description:5-Bromo-1,2,3-trimethoxybenzene is an organic compound characterized by its bromine and methoxy substituents on a benzene ring. The presence of three methoxy groups (-OCH3) at the 1, 2, and 3 positions, along with a bromine atom at the 5 position, contributes to its unique chemical properties and reactivity. This compound is typically a colorless to pale yellow solid, exhibiting moderate solubility in organic solvents due to the hydrophobic nature of the benzene ring and the polar methoxy groups. The bromine atom introduces electrophilic characteristics, making it a potential candidate for further chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the methoxy groups can influence the electronic distribution within the molecule, affecting its reactivity and interaction with other chemical species. 5-Bromo-1,2,3-trimethoxybenzene may find applications in organic synthesis, pharmaceuticals, and materials science, particularly in the development of functionalized aromatic compounds.
Formula:C9H11BrO3
InChI:InChI=1S/C9H11BrO3/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-5H,1-3H3
InChI key:InChIKey=XAOOZMATJDXDQJ-UHFFFAOYSA-N
SMILES:BrC=1C=C(OC)C(OC)=C(OC)C1
- Synonyms:
- 1,2,3-Trimethoxy-5-bromobenzene
- 1-Bromo-3,4,5-trimethoxybenzene
- 3,4,5-Triemethoxyphenylbromide
- 3,4,5-Trimethoxy-1-bromobenzene
- 3,4,5-Trimethoxybromoben
- 3,4,5-Trimethoxybromobenzene
- 3,4,5-Trimethoxyphenyl bromide
- 5-Bromopyrogallol trimethyl ether
- Benzene, 5-bromo-1,2,3-trimethoxy-
- Bromotrimethoxybenzene
- See more synonyms
