CAS 26776-70-5: Dihydroxyacetone dimer

Description:Dihydroxyacetone dimer, with the CAS number 26776-70-5, is a chemical compound that is a dimer of dihydroxyacetone (DHA), a simple carbohydrate and a ketone. This substance is characterized by its molecular structure, which consists of two dihydroxyacetone units linked together. It is typically a white to off-white solid and is soluble in water due to the presence of hydroxyl groups, which can form hydrogen bonds with water molecules. Dihydroxyacetone dimer is primarily known for its role in the cosmetic industry, particularly in self-tanning products, where it reacts with amino acids in the skin to produce a bronzing effect. Additionally, it may exhibit stability under various conditions, making it suitable for formulation in various products. Its safety profile is generally favorable, but like many chemicals, it should be handled with care to avoid potential skin irritation or allergic reactions. Overall, dihydroxyacetone dimer is valued for its functional properties in both cosmetic applications and potential uses in other fields.

Formula:(C₃H₆O₃)₂

InChI:InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2

InChI key:InChIKey=RXKJFZQQPQGTFL-UHFFFAOYSA-N

SMILES:O=C(CO)CO

Synonyms:
1,3-Dihydroxyacetone dimer
2-Propanone, 1,3-dihydroxy-, dimer
Dihydroxyacetone dimer

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1,3-Dihydroxypropan-2-one dimer REF: IN-DA003DJYCAS: 26776-70-5	98%	39.00 €~278.00 €	Thu 27 Mar 25
1,3-Dihydroxyacetone Dimer REF: TR-D450075CAS: 26776-70-5	- - -	92.00 €~178.00 €	Tue 08 Apr 25
1,3-Dihydroxyacetone dimer REF: 3D-FD171083CAS: 26776-70-5	Min. 96 Area-%	145.00 €~711.00 €	Mon 07 Apr 25
1,3-Dihydroxypropan-2-one dimer REF: 10-F476922CAS: 26776-70-5	95.0%	- - -	Discontinued product