CAS 26788-23-8: 4-Methoxyestradiol
Description:4-Methoxyestradiol is a synthetic derivative of estradiol, a naturally occurring estrogen. It is characterized by the presence of a methoxy group at the 4-position of the estradiol structure, which influences its biological activity. This compound is known for its potential anti-cancer properties, particularly in inhibiting the growth of certain tumors and modulating angiogenesis, the formation of new blood vessels. 4-Methoxyestradiol exhibits a range of biological effects, including anti-inflammatory and anti-proliferative activities, making it a subject of interest in cancer research and therapeutic applications. Additionally, it has been studied for its role in cardiovascular health and bone density regulation. The compound is typically administered in research settings and is not widely used in clinical practice. Its safety profile and pharmacokinetics are still under investigation, and further studies are needed to fully understand its mechanisms of action and potential therapeutic benefits. As with any chemical substance, proper handling and safety precautions are essential due to its biological activity.
Formula:C19H26O3
InChI:InChI=1S/C19H26O3/c1-19-10-9-12-11-5-7-16(20)18(22-2)14(11)4-3-13(12)15(19)6-8-17(19)21/h5,7,12-13,15,17,20-21H,3-4,6,8-10H2,1-2H3/t12-,13-,15+,17+,19+/m1/s1
InChI key:InChIKey=BCWZIZLVBYHFES-PYEWSWHRSA-N
SMILES:OC1=CC=C2C(=C1OC)CCC3C2CCC4(C)C(O)CCC34
- Synonyms:
- (17β)-4-Methoxyestra-1,3,5(10)-triene-3,17-diol
- 4-Methoxy-17β-estradiol
- 4-Methoxyestradiol
- Estra-1,3,5(10)-triene-3,17-diol, 4-methoxy-, (17beta)-
- Estra-1,3,5(10)-triene-3,17-diol, 4-methoxy-, (17β)-
- Estra-1,3,5(10)-triene-3,17β-diol, 4-methoxy-
