CAS 26963-43-9: 4-methyl-6-(thiophen-2-yl)pyrimidin-2-amine
Description:4-Methyl-6-(thiophen-2-yl)pyrimidin-2-amine is a heterocyclic organic compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 2 and 4. The presence of a methyl group at position 4 and a thiophene ring at position 6 contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. It is of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. The thiophene moiety can enhance the compound's electronic properties and influence its interactions with biological targets. Additionally, the presence of amino groups can facilitate hydrogen bonding, which is crucial for binding interactions in biological systems. Overall, 4-methyl-6-(thiophen-2-yl)pyrimidin-2-amine represents a class of compounds that may have applications in drug discovery and development, particularly in targeting specific enzymes or receptors.
Formula:C9H9N3S
InChI:InChI=1/C9H9N3S/c1-6-5-7(12-9(10)11-6)8-3-2-4-13-8/h2-5H,1H3,(H2,10,11,12)
- Synonyms:
- 2-Amino-4-methyl-6-(2-thienyl)pyrimidine
- 2-Pyrimidinamine, 4-methyl-6-(2-thienyl)-
- 4-Methyl-6-(2-thienyl)-2-pyrimidinamine
- 4-Methyl-6-(2-thienyl)-2-pyrimidinylamine
- 4-Methyl-6-(2-thienyl)pyrimidin-2-amine
- T6N Cnj Bz D1 F- Bt5Sj
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-Methyl-6-thiophen-2-yl-pyrimidin-2-ylamine REF: 10-F033287CAS: 26963-43-9 | 99.0% | 254.00 €~505.00 € | Tue 25 Mar 25 |
 | 4-METHYL-6-(2-THIENYL)-2-PYRIMIDINAMINE REF: IN-DA007MA3CAS: 26963-43-9 | - - - | To inquire | Thu 27 Mar 25 |
 | 4-Methyl-6-thien-2-ylpyrimidin-2-amine REF: 54-OR110457CAS: 26963-43-9 | - - - | To inquire | Thu 03 Apr 25 |
 | 4-Methyl-6-(thiophen-2-yl)pyrimidin-2-amine REF: 3D-FM54088CAS: 26963-43-9 | Min. 95% | - - - | Discontinued product |
4-Methyl-6-thiophen-2-yl-pyrimidin-2-ylamine
Ref: 10-F033287
| 1g | 505.00 € | ||
| 100mg | 254.00 € | ||
| 250mg | 311.00 € |
4-METHYL-6-(2-THIENYL)-2-PYRIMIDINAMINE
Ref: IN-DA007MA3
| Undefined size | To inquire |
4-Methyl-6-(thiophen-2-yl)pyrimidin-2-amine
Ref: 3D-FM54088
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
