CAS 27046-19-1: 4-Ketocyclophosphamide
Description:4-Ketocyclophosphamide, with the CAS number 27046-19-1, is a chemical compound that belongs to the class of alkylating agents, specifically a derivative of cyclophosphamide. It is characterized by the presence of a ketone functional group at the fourth position of the cyclophosphamide structure, which influences its reactivity and biological activity. This compound is primarily known for its role in cancer therapy, as it can form DNA cross-links, thereby inhibiting DNA replication and transcription in rapidly dividing cells. 4-Ketocyclophosphamide is typically administered in a prodrug form, requiring metabolic activation to exert its therapeutic effects. Its solubility and stability can vary depending on the formulation and conditions, making it essential to consider these factors in pharmaceutical applications. Additionally, like other alkylating agents, it may have associated side effects, including myelosuppression and potential toxicity to normal tissues, necessitating careful monitoring during treatment. Overall, 4-Ketocyclophosphamide is an important compound in oncology, contributing to the development of effective chemotherapy regimens.
Formula:C7H13Cl2N2O3P
InChI:InChI=1S/C7H13Cl2N2O3P/c8-2-4-11(5-3-9)15(13)10-7(12)1-6-14-15/h1-6H2,(H,10,12,13)
InChI key:InChIKey=VBMZHOCORXMDJU-UHFFFAOYSA-N
SMILES:O=C1NP(=O)(OCC1)N(CCCl)CCCl
- Synonyms:
- 2-[Bis(2-chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine 2,4-dioxide
- 4-Ketocyclophosphamide
- 4-Oxocyclophosphamide
- 4H-1,3,2-oxazaphosphorin-4-one, 2-[bis(2-chloroethyl)amino]tetrahydro-, 2-oxide
- Asta 5160
- NSC 139488
