![(βR)-β-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-furanbutanoic acid](https://static.cymitquimica.com/cas-image/308999-br-b-11-dimethylethoxy-carbonyl-amino-2-furanbutanoic-acid.png)
CAS 270596-33-3: (βR)-β-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-furanbutanoic acid
Description:The chemical substance known as (βR)-β-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-furanbutanoic acid, with the CAS number 270596-33-3, is an amino acid derivative characterized by its unique structural features. This compound contains a furan ring, which contributes to its aromatic properties, and a carboxylic acid functional group that imparts acidic characteristics. The presence of the dimethylethoxycarbonyl group enhances its stability and solubility in organic solvents, making it suitable for various chemical reactions and applications. The β-amino acid structure suggests potential biological activity, as β-amino acids are known to exhibit different properties compared to their α-counterparts, including altered conformational flexibility and potential for unique interactions in biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of novel therapeutics or as a building block in peptide synthesis. Its specific stereochemistry, indicated by the βR designation, may also play a crucial role in its biological activity and interactions.
Formula:C13H19NO5
InChI:InChI=1S/C13H19NO5/c1-13(2,3)19-12(17)14-9(8-11(15)16)7-10-5-4-6-18-10/h4-6,9H,7-8H2,1-3H3,(H,14,17)(H,15,16)/t9-/m1/s1
InChI key:InChIKey=WFTLLVUGUYBNDJ-SECBINFHSA-N
SMILES:O=C(OC(C)(C)C)NC(CC(=O)O)CC=1OC=CC1
- Synonyms:
- (3R)-3-[(tert-butoxycarbonyl)amino]-4-furan-2-ylbutanoic acid
- (βR)-β-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-furanbutanoic acid
- 2-Furanbutanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βR)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | (R)-3-((tert-Butoxycarbonyl)amino)-4-(furan-2-yl)butanoic acid REF: IN-DA003OEKCAS: 270596-33-3 | - - - | To inquire | Thu 27 Mar 25 |
 | Boc-(2-furyl)-D-b-homoalanine REF: 10-F493442CAS: 270596-33-3 | 95+% | - - - | Discontinued product |
 | Boc-(R)-3-amino-4-(2-furyl)-butyric acid REF: 3D-VKA59633CAS: 270596-33-3 | Min. 95% | - - - | Discontinued product |
(R)-3-((tert-Butoxycarbonyl)amino)-4-(furan-2-yl)butanoic acid
Ref: IN-DA003OEK
| Undefined size | To inquire |
Ref: 10-F493442
| 1g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
Boc-(R)-3-amino-4-(2-furyl)-butyric acid
Ref: 3D-VKA59633
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
