CAS 270596-43-5: Fmoc-(S)-3-amino-4-(4-chloro-phenyl)-butyric acid
Description:Fmoc-(S)-3-amino-4-(4-chloro-phenyl)-butyric acid is a synthetic amino acid derivative commonly used in peptide synthesis and drug development. It features a fluorene-9-methoxycarbonyl (Fmoc) protecting group, which is widely utilized in solid-phase peptide synthesis due to its stability under basic conditions and ease of removal under acidic conditions. The compound contains a chiral center, indicated by the (S) configuration, which is crucial for the biological activity of peptides. The presence of a 4-chloro-phenyl group enhances its hydrophobic character, potentially influencing the compound's interactions in biological systems. This amino acid derivative is typically used in the preparation of peptides that require specific stereochemistry and functional groups for desired biological activity. Its solubility properties may vary depending on the solvent, and it is generally stable under standard laboratory conditions. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its components.
Formula:C25H22ClNO4
InChI:InChI=1/C25H22ClNO4/c26-17-11-9-16(10-12-17)13-18(14-24(28)29)27-25(30)31-15-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-12,18,23H,13-15H2,(H,27,30)(H,28,29)/t18-/m0/s1
- Synonyms:
- (3S)-4-(4-chlorophenyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid
- Fmoc-β-HoPhe(4-Cl)-OH
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-chlorophenyl)butanoic acid REF: IN-DA003QMKCAS: 270596-43-5 | 98% | 64.00 €~629.00 € | Thu 27 Mar 25 |
![]() | (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-chlorophenyl)butanoic acid REF: 54-OR76579CAS: 270596-43-5 | 95% | 197.00 €~775.00 € | Fri 28 Mar 25 |
![]() | Fmoc-4-chloro-L-β-homophenylalanine REF: 3D-FF50195CAS: 270596-43-5 | Min. 95% | - - - | Discontinued product |

(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-chlorophenyl)butanoic acid
Ref: IN-DA003QMK
1g | 137.00 € | ||
5g | 629.00 € | ||
100mg | 64.00 € | ||
250mg | 95.00 € |

(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-chlorophenyl)butanoic acid
Ref: 54-OR76579
1g | 197.00 € | ||
5g | 775.00 € |

Fmoc-4-chloro-L-β-homophenylalanine
Ref: 3D-FF50195
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |