CAS 271-45-4: 2H-Pyrazolo[3,4-c]pyridine

Description: 2H-Pyrazolo[3,4-c]pyridine is a heterocyclic organic compound characterized by a fused ring system that includes both pyrazole and pyridine moieties. This compound typically exhibits a planar structure due to the conjugated system of double bonds, which contributes to its stability and potential reactivity. It is known for its aromatic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. The presence of nitrogen atoms in the ring enhances its basicity and can influence its interaction with other chemical species. 2H-Pyrazolo[3,4-c]pyridine has been studied for its biological activities, including potential applications in medicinal chemistry, where it may exhibit pharmacological properties such as anti-inflammatory or anticancer effects. Its solubility can vary depending on the solvent, and it may participate in coordination chemistry due to the nitrogen atoms, which can act as ligands. Overall, this compound is of interest in both synthetic and medicinal chemistry for its unique structural features and potential applications.

Formula: C₆H₅N₃

InChI: InChI=1S/C6H5N3/c1-2-7-4-6-5(1)3-8-9-6/h1-4H,(H,8,9)

InChI key: InChIKey=KNYHISBJRQVMAZ-UHFFFAOYSA-N

SMILES: N=1C=CC2=CNN=C2C1

Synonyms:

• 2H-Pyrazolo[3,4-c]pyridine
• 6-Aza-2H-indazole

2H-Pyrazolo[3,4-c]pyridine

CAS: 271-45-4

• Formula: C₆H₅N₃
• Purity: 95%
• Color and Shape: Solid
• Molecular weight: 119.124

3H-Pyrazolo[3,4-c]pyridine

CAS: 271-45-4

3H-Pyrazolo[3,4-c]pyridine is a potential ATP binding site inhibitor that inhibits the activity of PIM-1 kinase. …

• Purity: Min. 95%