CAS 27350-01-2: 2-(Cyanomethyl)benzenesulfonamide

Description: 2-(Cyanomethyl)benzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring, which is further substituted with a cyanomethyl group. This compound typically exhibits properties associated with both sulfonamides and nitriles, including potential solubility in polar solvents due to the sulfonamide moiety. The presence of the cyanomethyl group introduces a nitrile functionality, which can participate in various chemical reactions, such as nucleophilic additions or cycloadditions. The sulfonamide group contributes to the compound's potential biological activity, as many sulfonamides are known for their antimicrobial properties. Additionally, the compound may exhibit moderate to high stability under standard conditions, but its reactivity can vary depending on the specific functional groups and their electronic effects. Overall, 2-(Cyanomethyl)benzenesulfonamide is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₈H₈N₂O₂S

InChI: InChI=1S/C8H8N2O2S/c9-6-5-7-3-1-2-4-8(7)13(10,11)12/h1-4H,5H2,(H2,10,11,12)

InChI key: InChIKey=QEVWMXVHIOULGX-UHFFFAOYSA-N

SMILES: N#CCC=1C=CC=CC1S(=O)(=O)N

Synonyms:

• 2-(Cyanomethyl)benzenesulfonamide
• Benzenesulfonamide, 2-(cyanomethyl)-
• o-Toluenesulfonamide, α-cyano-
• 2-(Cyanomethyl)benzene-1-sulfonamide

Benzenesulfonamide, 2-(cyanomethyl)- (9CI)

CAS: 27350-01-2

• Formula: C₈H₈N₂O₂S
• Molecular weight: 196.2263

2-(Cyanomethyl)benzene-1-sulfonamide

CAS: 27350-01-2

Versatile small molecule scaffold

• Formula: C₈H₈N₂O₂S
• Purity: Min. 95%
• Molecular weight: 196.23 g/mol

2-(Cyanomethyl)benzene-1-sulfonamide

CAS: 27350-01-2

• Purity: 98%
• Molecular weight: 196.22000122070312