CAS 2736-21-2: 1H-Indole-3-ethanamine, 6-methoxy-, hydrochloride (1:1)

Description:1H-Indole-3-ethanamine, 6-methoxy-, hydrochloride (1:1), with the CAS number 2736-21-2, is a chemical compound that belongs to the class of indole derivatives. This substance features an indole ring, which is a bicyclic structure composed of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of a methoxy group at the 6-position of the indole ring enhances its solubility and reactivity. As an ethanamine derivative, it contains an amino group that can participate in various chemical reactions, including those typical of amines. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically improves its stability and solubility in water. This compound may exhibit biological activity, potentially influencing neurotransmitter systems, and is of interest in pharmacological research. Its characteristics, including melting point, solubility, and reactivity, can vary based on the specific conditions and purity of the sample.

Formula:C₁₁H₁₄N₂O·ClH

InChI:InChI=1S/C11H14N2O.ClH/c1-14-9-2-3-10-8(4-5-12)7-13-11(10)6-9;/h2-3,6-7,13H,4-5,12H2,1H3;1H

InChI key:InChIKey=ANTAOYZCCFNXOG-UHFFFAOYSA-N

SMILES:Cl.O(C=1C=CC2=C(C1)NC=C2CCN)C