CAS 2746-07-8: 2-chloro-N-ethyl-N-methylacetamide
Description:2-Chloro-N-ethyl-N-methylacetamide is an organic compound characterized by its amide functional group, which features a chlorine atom and two alkyl substituents on the nitrogen atom. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in polar organic solvents and exhibits moderate stability under standard conditions. The presence of the chloro group enhances its reactivity, making it useful in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals. The compound's molecular structure contributes to its properties, including its boiling point and melting point, which are influenced by intermolecular forces such as hydrogen bonding and dipole-dipole interactions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to mitigate any potential hazards associated with this chemical. Overall, 2-chloro-N-ethyl-N-methylacetamide is a versatile compound with applications in synthetic organic chemistry.
Formula:C5H10ClNO
InChI:InChI=1/C5H10ClNO/c1-3-7(2)5(8)4-6/h3-4H2,1-2H3
- Synonyms:
- Acetamide, 2-chloro-N-ethyl-N-methyl-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Acetamide, 2-chloro-N-ethyl-N-methyl- REF: IN-DA00C1UHCAS: 2746-07-8 | - - - | To inquire | Thu 27 Mar 25 |
 | 2-Chloro-N-ethyl-N-methylacetamide REF: 10-F080286CAS: 2746-07-8 | 95.0% | To inquire | Tue 08 Apr 25 |
 | 2-Chloro-N-ethyl-N-methylacetamide REF: 3D-FC115395CAS: 2746-07-8 | Min. 95% | - - - | Discontinued product |
| 2-Chloro-N-ethyl-N-methylacetamide REF: 3D-CAA74607CAS: 2746-07-8 | Min. 95% | - - - | Discontinued product |
Ref: IN-DA00C1UH
| Undefined size | To inquire |
2-Chloro-N-ethyl-N-methylacetamide
Ref: 10-F080286
| 1g | 31.00 € | ||
| 5g | 89.00 € | ||
| 25g | To inquire | ||
| 100g | To inquire |
2-Chloro-N-ethyl-N-methylacetamide
Ref: 3D-FC115395
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
2-Chloro-N-ethyl-N-methylacetamide
Ref: 3D-CAA74607
| 250mg | Discontinued | Request information | |
| 2500mg | Discontinued | Request information |
