CAS 274901-75-6: 4-chloro-2-(propanoylamino)benzoic acid

Description: 4-Chloro-2-(propanoylamino)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a chlorine atom and a propanoylamino group. The presence of the chlorine atom at the para position relative to the carboxylic acid group contributes to its reactivity and potential applications in various chemical reactions. The propanoylamino group introduces an amide functionality, which can influence the compound's solubility and biological activity. This compound is likely to exhibit moderate polarity due to the combination of hydrophilic carboxylic acid and amide groups and a hydrophobic aromatic ring. Its molecular structure suggests potential uses in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound may participate in various chemical reactions, including acylation and nucleophilic substitutions, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₀H₁₀ClNO₃

InChI: InChI=1/C10H10ClNO3/c1-2-9(13)12-8-5-6(11)3-4-7(8)10(14)15/h3-5H,2H2,1H3,(H,12,13)(H,14,15)

Synonyms:

• 4-Chloro-2-(propionylamino)benzoic acid
• Benzoic Acid, 4-Chloro-2-[(1-Oxopropyl)Amino]-

Benzoic acid, 4-chloro-2-[(1-oxopropyl)amino]-

CAS: 274901-75-6

• Formula: C₁₀H₁₀ClNO₃
• Molecular weight: 227.6443

4-chloro-2-(propionylamino)benzoic acid

CAS: 274901-75-6

• Purity: 95.0%
• Molecular weight: 227.63999938964844

4-Chloro-2-(propionylamino)benzoic acid

CAS: 274901-75-6

Versatile small molecule scaffold

• Formula: C₁₀H₁₀ClNO₃
• Purity: Min. 95%
• Molecular weight: 227.64 g/mol