CAS 2759-14-0: 1H-Indol-5-amine,2,3-dihydro-, hydrochloride (1:2)

Description:1H-Indol-5-amine, 2,3-dihydro-, hydrochloride (1:2), with the CAS number 2759-14-0, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features an amine functional group at the 5-position of the indole, contributing to its basicity and potential reactivity. The dihydro form indicates the presence of additional hydrogen atoms, suggesting a saturated structure that may influence its physical and chemical properties, such as solubility and stability. The hydrochloride salt form enhances its solubility in water, making it more suitable for various applications, including pharmaceutical formulations. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its characteristics, including melting point, boiling point, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in different environments.

Formula:C₈H₁₀N₂・2ClH

InChI:InChI=1S/C8H10N2.2ClH/c9-7-1-2-8-6(5-7)3-4-10-8;;/h1-2,5,10H,3-4,9H2;2*1H

InChI key:InChIKey=VSZOMPGFSSVFJL-UHFFFAOYSA-N

SMILES:Cl.NC1=CC=C2NCCC2=C1

Synonyms:
1H-Indol-5-amine, 2,3-dihydro-, dihydrochloride
1H-Indol-5-amine,2,3-dihydro-, dihydrochloride (9CI)
5-Aminoindoline dihydrochloride
Indoline, 5-amino-, dihydrochloride
Indoline, 5-amino-, dihydrochloride (7CI)

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1H-Indol-5-amine, 2,3-dihydro-, dihydrochloride REF: IN-DA00I57SCAS: 2759-14-0	95%	55.00 €~176.00 €	Thu 27 Mar 25
5-Aminoindoline dihydrochloride REF: 10-F018183CAS: 2759-14-0	95.0%	183.00 €	Tue 01 Apr 25
5-Amino-2,3-dihydroindole dihydrochloride REF: 3D-FA52279CAS: 2759-14-0	Min. 95%	- - -	Discontinued product