CAS 2769-40-6

N-(4-ethoxyphenyl)-2-phenylbutanamide

Description:

N-(4-ethoxyphenyl)-2-phenylbutanamide, with the CAS number 2769-40-6, is an organic compound characterized by its amide functional group, which is formed by the reaction of a carboxylic acid and an amine. This compound features a butanamide backbone substituted with a 4-ethoxyphenyl group and a phenyl group, contributing to its structural complexity and potential biological activity. The presence of the ethoxy group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, and its synthesis may involve standard organic reactions such as acylation. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other functional groups. Further studies would be necessary to fully elucidate its properties and potential uses in pharmaceuticals or other fields.

Formula: C₁₈H₂₁NO₂

InChI: InChI=1/C18H21NO2/c1-3-17(14-8-6-5-7-9-14)18(20)19-15-10-12-16(13-11-15)21-4-2/h5-13,17H,3-4H2,1-2H3,(H,19,20)

SMILES: CCC(c1ccccc1)C(=O)Nc1ccc(cc1)OCC

Synonyms:

• benzeneacetamide, N-(4-ethoxyphenyl)-alpha-ethyl-