CAS 285979-83-1

Propanoic-2-d acid, 2-hydroxy-, monosodium salt, (2S)-

Description:

Propanoic-2-d acid, 2-hydroxy-, monosodium salt, (2S)-, also known by its CAS number 285979-83-1, is a chemical compound characterized by its structure as a sodium salt of a hydroxy propanoic acid. This compound features a propanoic acid backbone with a hydroxyl group (-OH) attached to the second carbon, which contributes to its classification as a hydroxy acid. The presence of the sodium ion indicates that it is a salt form, which typically enhances its solubility in water compared to its acid counterpart. The (2S) designation refers to the specific stereochemistry of the molecule, indicating that it has a particular three-dimensional arrangement of atoms. This compound may exhibit properties typical of hydroxy acids, such as being involved in biochemical processes and potentially serving as a buffering agent. Its applications could span various fields, including pharmaceuticals, food additives, and biochemistry, where it may play a role in metabolic pathways or as a precursor in synthetic reactions.

Formula: C₃H₅DO₃·Na

InChI: InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/t2-;/m0./s1/i2D;

InChI key: InChIKey=ZZUUMCMLIPRDPI-QEKRQAICSA-N

SMILES: [C@](C(O)=O)(C)(O)[2H].[Na]

Synonyms:

• Propanoic-2-d acid, 2-hydroxy-, monosodium salt, (2S)-

Sodium L-Lactate-2-d1

CAS: 285979-83-1

Formula: CH₃CD(OH)COONa

Purity: 98 atom % D

Color and Shape: Pale Yellow. Viscous Liquid

Molecular weight: 113.01992

Ref: 3U-D3837

Sodium L-Lactate-2-d1

Controlled Product

CAS: 285979-83-1

Applications Sodium L-Lactate-2-d1 (CAS# 285979-83-1) is a useful isotopically labeled research compound.

Formula: C₃H₄DNaO₃

Color and Shape: Neat

Molecular weight: 113.07

Ref: TR-L113506