CAS 478049-16-0
:4-Chloro-2-(4-fluorophenyl)-5-(2-propen-1-ylamino)-3(2H)-pyridazinone
Description:
4-Chloro-2-(4-fluorophenyl)-5-(2-propen-1-ylamino)-3(2H)-pyridazinone is a synthetic organic compound characterized by its pyridazinone core structure, which features a chloro substituent and a fluorophenyl group. This compound exhibits a range of chemical properties typical of pyridazinones, including potential biological activity due to the presence of the amino and propenyl groups, which may influence its reactivity and interaction with biological targets. The chloro and fluoro substituents can enhance lipophilicity and modulate the compound's pharmacokinetic properties. The presence of the propenylamino group suggests potential for further chemical reactivity, possibly allowing for conjugation or modification in drug development applications. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique structure may also contribute to its solubility and stability in various solvents, making it suitable for diverse applications in research and industry.
Formula:C13H11ClFN3O
InChI:InChI=1S/C13H11ClFN3O/c1-2-7-16-11-8-17-18(13(19)12(11)14)10-5-3-9(15)4-6-10/h2-6,8,16H,1,7H2
InChI key:InChIKey=DBDQCZKFCIAVOA-UHFFFAOYSA-N
SMILES:O=C1N(N=CC(NCC=C)=C1Cl)C2=CC=C(F)C=C2
Synonyms:- 4-Chloro-2-(4-fluorophenyl)-5-(2-propen-1-ylamino)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4-chloro-2-(4-fluorophenyl)-5-(2-propen-1-ylamino)-
- 3(2H)-Pyridazinone, 4-chloro-2-(4-fluorophenyl)-5-(2-propenylamino)-
- 5-(ALLYLAMINO)-4-CHLORO-2-(4-FLUOROPHENYL)-3(2H)-PYRIDAZINONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-2-(4-fluorophenyl)-5-[(prop-2-en-1-yl)amino]-2,3-dihydropyridazin-3-one
CAS:<p>4-Chloro-2-(4-fluorophenyl)-5-[(prop-2-en-1-yl)amino]-2,3-dihydropyridazin-3-one</p>Purity:techMolecular weight:279.70g/mol
