![3-chloro-N-{2-[4-(2-methylpropyl)phenyl]propyl}tricyclo[3.3.1.1~3,7~]decane-1-carboxamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F320866-3-chloro-n-2-4-2-methylpropyl-phenyl-propyl-tricyclo-3-3-1-1-37-decane-1-carboxamide.webp&w=3840&q=75)
CAS 5530-99-4
:3-chloro-N-{2-[4-(2-methylpropyl)phenyl]propyl}tricyclo[3.3.1.1~3,7~]decane-1-carboxamide
Description:
3-chloro-N-{2-[4-(2-methylpropyl)phenyl]propyl}tricyclo[3.3.1.1^3,7]decane-1-carboxamide is a complex organic compound characterized by its tricyclic structure, which contributes to its unique chemical properties. The presence of a chloro group introduces reactivity, while the carboxamide functional group enhances its solubility in polar solvents and may influence its biological activity. The compound features a branched alkyl group (2-methylpropyl) attached to a phenyl ring, which can affect its steric and electronic properties, potentially impacting its interactions with biological targets. The tricyclic framework provides rigidity, which can be crucial for the compound's conformational stability and its ability to fit into specific binding sites. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its structural complexity and functional groups suggest potential applications in drug development, although specific biological activities would require empirical investigation.
Formula:C24H34ClNO
InChI:InChI=1/C24H34ClNO/c1-16(2)8-18-4-6-21(7-5-18)17(3)14-26-22(27)23-10-19-9-20(11-23)13-24(25,12-19)15-23/h4-7,16-17,19-20H,8-15H2,1-3H3,(H,26,27)
SMILES:CC(C)Cc1ccc(cc1)C(C)CN=C(C12CC3CC(C1)CC(C3)(C2)Cl)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
